4-Bromodiphenylamine
- Product Name4-Bromodiphenylamine
- CAS54446-36-5
- MFC12H10BrN
- MW248.12
- EINECS626-191-6
- MOL File54446-36-5.mol
Chemical Properties
| Melting point | 85-89 °C |
| Boiling point | 318°C(lit.) |
| Density | 1.445±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| solubility | soluble in Toluene |
| form | powder to crystal |
| pka | 0.11±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C12H10BrN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9,14H |
| InChIKey | CCIVUDMVXNBUCY-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=C(Br)C=C1 |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-37/38-41-51/53 |
| Safety Statements | 26-36/37/39-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |