Pyridinium dichromate
- Product NamePyridinium dichromate
- CAS20039-37-6
- MFC5H7Cr2NO7
- MW297.1
- EINECS243-478-8
- MOL File20039-37-6.mol
Chemical Properties
| Melting point | 152-153 °C(lit.) |
| Density | 1.71[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in DMSO |
| form | Crystalline Powder |
| color | Orange to brown |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Exposure limits | OSHA: Ceiling 0.1 mg/m3 NIOSH: IDLH 15 mg/m3; TWA 0.0002 mg/m3 |
| InChI | 1S/2C5H5N.2Cr.2H2O.5O/c2*1-2-4-6-5-3-1;;;;;;;;;/h2*1-5H;;;2*1H2;;;;;/q;;2*+1;;;;;;;/p-2 |
| InChIKey | BNSOYWDFFBDEFB-UHFFFAOYSA-L |
| SMILES | c1ccncc1.c2ccncc2.O[Cr](=O)(=O)O[Cr](O)(=O)=O |
| LogP | -3.7 at 20℃ |
| CAS DataBase Reference | 20039-37-6(CAS DataBase Reference) |
| EPA Substance Registry System | Chromic acid (H2Cr2O7), compd. with pyridine (1:2) (20039-37-6) |
Safety Information
| Hazard Codes | O,T,N,Xn,F,Xi |
| Risk Statements | 49-8-43-50/53-61-60-46-45-20/21/22-40-36/37/38-34-11 |
| Safety Statements | 53-45-60-61-37-29-24-17-36/37/39-27-22-26 |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 2 |
| F | 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 5.1 |
| PackingGroup | II |
| HS Code | 29333100 |
| Storage Class | 4.1A - Other explosive hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Inhalation Eye Dam. 1 Flam. Sol. 1 Skin Corr. 1B Skin Sens. 1 |
