Pyridinium dichromate
- Product NamePyridinium dichromate
- CAS20039-37-6
- CBNumberCB4390259
- MFC5H7Cr2NO7
- MW297.1
- EINECS243-478-8
- MDL NumberMFCD00013105
- MOL File20039-37-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 152-153 °C(lit.) |
| Density | 1.71[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in DMSO |
| form | Crystalline Powder |
| color | Orange to brown |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| Exposure limits | OSHA: Ceiling 0.1 mg/m3 NIOSH: IDLH 15 mg/m3; TWA 0.0002 mg/m3 |
| InChI | 1S/2C5H5N.2Cr.2H2O.5O/c2*1-2-4-6-5-3-1;;;;;;;;;/h2*1-5H;;;2*1H2;;;;;/q;;2*+1;;;;;;;/p-2 |
| InChIKey | BNSOYWDFFBDEFB-UHFFFAOYSA-L |
| SMILES | c1ccncc1.c2ccncc2.O[Cr](=O)(=O)O[Cr](O)(=O)=O |
| LogP | -3.7 at 20℃ |
| CAS DataBase Reference | 20039-37-6(CAS DataBase Reference) |
| FDA UNII | Y7AV7UFN7K |
| EPA Substance Registry System | Chromic acid (H2Cr2O7), compd. with pyridine (1:2) (20039-37-6) |
| UNSPSC Code | 12352005 |
Safety
| Symbol(GHS) |
     
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H272-H314-H317-H350i-H410 | |||||||||
| Precautionary statements | P210-P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| Hazard Codes | O,T,N,Xn,F,Xi | |||||||||
| Risk Statements | 49-8-43-50/53-61-60-46-45-20/21/22-40-36/37/38-34-11 | |||||||||
| Safety Statements | 53-45-60-61-37-29-24-17-36/37/39-27-22-26 | |||||||||
| RIDADR | UN 1479 5.1/PG 2 | |||||||||
| WGK Germany | 2 | |||||||||
| F | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 5.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29333100 | |||||||||
| Storage Class | 4.1A - Other explosive hazardous materials | |||||||||
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Inhalation Eye Dam. 1 Flam. Sol. 1 Skin Corr. 1B Skin Sens. 1 | |||||||||
| NFPA 704: |
|
