2,2'-Dipicolylamine
- Product Name2,2'-Dipicolylamine
- CAS1539-42-0
- MFC12H13N3
- MW199.25
- EINECS216-266-8
- MOL File1539-42-0.mol
Chemical Properties
| Boiling point | 139-141 °C/1 mmHg (lit.) |
| Density | 1.107 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | water: soluble (partially miscible)(lit.) |
| pka | 5.89±0.20(Predicted) |
| form | clear liquid |
| color | White to Yellow to Green |
| Water Solubility | water: soluble (partially miscible)(lit.) |
| InChI | InChI=1S/C12H13N3/c1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15-12/h1-8,13H,9-10H2 |
| InChIKey | KXZQYLBVMZGIKC-UHFFFAOYSA-N |
| SMILES | C1(CNCC2=NC=CC=C2)=NC=CC=C1 |
| EPA Substance Registry System | 2,2'-Dipicolylamine (1539-42-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |