| Melting point |
68 °C |
| Boiling point |
315 °C(lit.) |
| Density |
1.06 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.57(lit.) |
| Flash point |
107-110°C/15mm |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
14.51±0.10(Predicted) |
| form |
clear liquid |
| color |
Colorless to Yellow to Green |
| Water Solubility |
Not miscible or difficult to mix with water. |
| BRN |
2369849 |
| InChI |
InChI=1S/C11H14N2O/c12-7-4-8-13(9-10-14)11-5-2-1-3-6-11/h1-3,5-6,14H,4,8-10H2 |
| InChIKey |
WZJJWQVBLSPALW-UHFFFAOYSA-N |
| SMILES |
N(C1C=CC=CC=1)(CCO)CCC#N |
| CAS DataBase Reference |
92-64-8(CAS DataBase Reference) |
| EPA Substance Registry System |
Propanenitrile, 3-[(2-hydroxyethyl)phenylamino]- (92-64-8) |
