Chemical Properties
| Melting point | 58-60° |
| alpha | D24 +31° (methanol) |
| Boiling point | 314.44°C (rough estimate) |
| Density | 1.1649 (rough estimate) |
| refractive index | 1.5557 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMF:25.0(Max Conc. mg/mL);107.62(Max Conc. mM) DMSO:25.0(Max Conc. mg/mL);107.62(Max Conc. mM) Ethanol:5.0(Max Conc. mg/mL);21.52(Max Conc. mM) |
| form | Solid |
| color | White to off-white |
| optical activity | [α]/D 29±2°, c = 0.5 in methanol |
| BRN | 15362 |
| Major Application | food and beverages |
| InChI | InChI=1S/C14H16O3/c1-16-13-9-12(17-14(15)10-13)8-7-11-5-3-2-4-6-11/h2-6,10,12H,7-9H2,1H3/t12-/m0/s1 |
| InChIKey | VOOYTQRREPYRIW-LBPRGKRZSA-N |
| SMILES | C1(=O)O[C@@H](CCC2=CC=CC=C2)CC(OC)=C1 |
| LogP | 1.950 (est) |
Safety Information
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |