Chemical Properties
| Melting point | 168℃ |
| Boiling point | 436.5±45.0 °C(Predicted) |
| Density | 1.42 |
| storage temp. | 2-8°C |
| solubility | DMSO : 31.25 mg/mL (101.99 mM; Need ultrasonic) |
| form | powder |
| pka | 8.67±0.40(Predicted) |
| color | Yellow-brown |
| optical activity | [α]/D 295 to 245° |
| InChI | InChI=1/C20H22N2O/c1-3-19-11-22(2)16-9-20(19)13-6-4-5-7-15(13)21-18(20)17-8-14(19)12(16)10-23-17/h3-7,12,14,16-17H,1,8-11H2,2H3/t12-,14+,16-,17+,19-,20+/s3 |
| InChIKey | VTLYEMHGPMGUOT-KWZROIJWNA-N |
| SMILES | C1C=CC2N=C3[C@]4([H])OC[C@@]5([H])[C@]([H])([C@]6(C=C)CN(C)[C@]5(C[C@@]36C=2C=1)[H])C4 |&1:6,10,12,14,20,22,r| |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral |