sec-Butyl methyl ether
- Product Namesec-Butyl methyl ether
- CAS6795-87-5
- MFC5H12O
- MW88.15
- EINECS
- MOL File6795-87-5.mol
Chemical Properties
| Melting point | -117.26°C (estimate) |
| Boiling point | 75 °C(lit.) |
| Density | 0.742 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | −22 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform, Methanol (Slightly) |
| form | Colourless Liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Miscible with water, alcohol, ether and acetone. |
| Henry's Law Constant | 6.7×10-3 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Stability | Volatile |
| InChI | InChI=1S/C5H12O/c1-4-5(2)6-3/h5H,4H2,1-3H3 |
| InChIKey | FVNIMHIOIXPIQT-UHFFFAOYSA-N |
| SMILES | CC(OC)CC |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11 |
| Safety Statements | 7-16-2017/7/16 |
| RIDADR | UN 2350 3/PG 2 |
| WGK Germany | 3 |
| RTECS | KN5249500 |
| Hazard Note | Irritant |
| HazardClass | 3.1 |
| PackingGroup | II |
| HS Code | 29091990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
