Amsacrine hydrochloride
- Product NameAmsacrine hydrochloride
- CAS54301-15-4
- MFC21H20ClN3O3S
- MW429.92
- EINECS637-255-8
- MOL File54301-15-4.mol
Chemical Properties
| Melting point | 197-199 °C(lit.) |
| storage temp. | Refrigerator |
| solubility | DMSO: 10 mg/mL with heat and sonication |
| form | powder |
| color | red to brown |
| InChI | 1S/C21H19N3O3S.ClH/c1-27-20-13-14(24-28(2,25)26)11-12-19(20)23-21-15-7-3-5-9-17(15)22-18-10-6-4-8-16(18)21;/h3-13,24H,1-2H3,(H,22,23);1H |
| InChIKey | WDISRLXRMMTXEV-UHFFFAOYSA-N |
| SMILES | Cl.COc1cc(NS(C)(=O)=O)ccc1Nc2c3ccccc3nc4ccccc24 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | PB1081000 |
| HS Code | 2933.99.8290 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 2 Muta. 2 Repr. 2 Skin Sens. 1 |