N-(Chloromethyl)phthalimide
- Product NameN-(Chloromethyl)phthalimide
- CAS17564-64-6
- MFC9H6ClNO2
- MW195.6
- EINECS241-541-4
- MOL File17564-64-6.mol
Chemical Properties
| Melting point | 131-135 °C (lit.) |
| Boiling point | 305.2±25.0 °C(Predicted) |
| Density | 1.3228 (rough estimate) |
| refractive index | 1.5790 (estimate) |
| storage temp. | 2-8°C |
| solubility | chloroform: soluble50mg/mL |
| pka | -2.63±0.20(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | slightly soluble |
| BRN | 140942 |
| InChI | InChI=1S/C9H6ClNO2/c10-5-11-8(12)6-3-1-2-4-7(6)9(11)13/h1-4H,5H2 |
| InChIKey | JKGLRGGCGUQNEX-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CCl |
| CAS DataBase Reference | 17564-64-6(CAS DataBase Reference) |
| NIST Chemistry Reference | N-(chloromethyl)phthalimide(17564-64-6) |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 2-(chloromethyl)- (17564-64-6) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-52/53-43-22 |
| Safety Statements | 26-36-37/39-61-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| F | 9-21 |
| TSCA | TSCA listed |
| HS Code | 29251995 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |