Phthalhydrazide
- Product NamePhthalhydrazide
- CAS1445-69-8
- MFC8H6N2O2
- MW162.15
- EINECS215-893-4
- MOL File1445-69-8.mol
Chemical Properties
| Melting point | >300 °C (lit.) |
| Boiling point | 288.82°C (rough estimate) |
| Density | 1.3264 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in acetone and acetic acid. |
| form | Powder and Chunks |
| pka | 10.70±0.20(Predicted) |
| color | White |
| BRN | 135926 |
| InChI | InChI=1S/C8H6N2O2/c11-7-5-3-1-2-4-6(5)8(12)10-9-7/h1-4H,(H,9,11)(H,10,12) |
| InChIKey | KGLPWQKSKUVKMJ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)NN1 |
| CAS DataBase Reference | 1445-69-8(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | TH8890080 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,intraperitoneal,700mg/kg (700mg/kg),Archiv der Pharmazie Vol. 327, Pg. 237, 1994. |
