7-Amino-4-methyl-3-coumarinylacetic acid
- Product Name7-Amino-4-methyl-3-coumarinylacetic acid
- CAS106562-32-7
- MFC12H11NO4
- MW233.22
- EINECS
- MOL File106562-32-7.mol
Chemical Properties
| Boiling point | 512.2±50.0 °C(Predicted) |
| Density | 1.391±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMF: soluble |
| form | powder to crystal |
| pka | 3.80±0.10(Predicted) |
| color | Light yellow to Brown |
| Appearance | Solid |
| ex/em | λex 347 nm; λem 444 nm in conjugate |
| λmax | 344nm(Buffer)(lit.) |
| BRN | 7927205 |
| InChI | InChI=1S/C12H11NO4/c1-6-8-3-2-7(13)4-10(8)17-12(16)9(6)5-11(14)15/h2-4H,5,13H2,1H3,(H,14,15) |
| InChIKey | QEQDLKUMPUDNPG-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(N)=CC=C2C(C)=C1CC(O)=O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
