6-Hydroxy-5-nitro-2-picoline
- Product Name6-Hydroxy-5-nitro-2-picoline
- CAS39745-39-6
- MFC6H6N2O3
- MW154.12
- EINECS
- MOL File39745-39-6.mol
Chemical Properties
| Melting point | 225-226 C |
| Boiling point | 277.46°C (rough estimate) |
| Density | 1.4564 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.47±0.10(Predicted) |
| color | Light yellow to Brown to Dark green |
| InChI | 1S/C6H6N2O3/c1-4-2-3-5(8(10)11)6(9)7-4/h2-3H,1H3,(H,7,9) |
| InChIKey | YVYDGIGILRUPED-UHFFFAOYSA-N |
| SMILES | Cc1ccc(c(O)n1)[N+]([O-])=O |
| CAS DataBase Reference | 39745-39-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 37/39-26-36-39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
