3-Hydroxy-6-methyl-2-nitropyridine
- Product Name3-Hydroxy-6-methyl-2-nitropyridine
- CAS15128-90-2
- MFC6H6N2O3
- MW154.12
- EINECS239-192-8
- MOL File15128-90-2.mol
Chemical Properties
| Melting point | 106-107 °C (lit.) |
| Boiling point | 277.46°C (rough estimate) |
| Density | 1.4564 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 1.01±0.22(Predicted) |
| color | Light orange to Yellow to Green |
| BRN | 974751 |
| InChI | InChI=1S/C6H6N2O3/c1-4-2-3-5(9)6(7-4)8(10)11/h2-3,9H,1H3 |
| InChIKey | WZMGQHIBXUAYGS-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC(C)=CC=C1O |
| CAS DataBase Reference | 15128-90-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |