4-Nitro-1,3-dimethylbenzene
- Product Name4-Nitro-1,3-dimethylbenzene
- CAS89-87-2
- MFC8H9NO2
- MW151.16
- EINECS201-947-4
- MOL File89-87-2.mol
Chemical Properties
| Melting point | 7-9 °C(lit.) |
| Boiling point | 244 °C(lit.) |
| Density | 1.117 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 225 °F |
| storage temp. | Store below +30°C. |
| form | Liquid |
| color | Clear yellow |
| Water Solubility | 133 mg/L (20 ºC) |
| BRN | 1865656 |
| Henry's Law Constant | 3.9×10-1 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| Stability | Stable. Incompatible with strong bases, strong oxidizing agents. |
| InChI | 1S/C8H9NO2/c1-6-3-4-8(9(10)11)7(2)5-6/h3-5H,1-2H3 |
| InChIKey | BBUPBICWUURTNP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(c(C)c1)[N+]([O-])=O |
| CAS DataBase Reference | 89-87-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2,4-dimethyl-1-nitro-(89-87-2) |
| EPA Substance Registry System | 4-Nitro-m-xylene (89-87-2) |
Safety Information
| Hazard Codes | Xn,T |
| Risk Statements | 22-20/21/22-36/37/38-23/24/25 |
| Safety Statements | 36/37-45-36/37/39-26-13 |
| RIDADR | UN 1665 6.1/PG 2 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29042000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |