5-Bromoquinoline
- Product Name5-Bromoquinoline
- CAS4964-71-0
- MFC9H6BrN
- MW208.05
- EINECS639-373-5
- MOL File4964-71-0.mol
Chemical Properties
| Melting point | 43-48 °C |
| Boiling point | 105-107°C 1mm |
| Density | 1.5617 (rough estimate) |
| refractive index | 1.6641 (estimate) |
| Flash point | 105-107°C/1mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.88±0.12(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Green |
| BRN | 115148 |
| InChI | InChI=1S/C9H6BrN/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H |
| InChIKey | CHODTZCXWXCALP-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(Br)C=CC=2)C=CC=1 |
| CAS DataBase Reference | 4964-71-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |