2',5'-Dichloroacetophenone
- Product Name2',5'-Dichloroacetophenone
- CAS2476-37-1
- MFC8H6Cl2O
- MW189.04
- EINECS219-605-8
- MOL File2476-37-1.mol
Chemical Properties
| Melting point | 14 °C |
| Boiling point | 128 °C/12 mmHg |
| Density | 1.33 |
| refractive index | 1.56 |
| Flash point | Not applicable |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.312 |
| BRN | 1865043 |
| InChI | InChI=1S/C8H6Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4H,1H3 |
| InChIKey | CYNFEPKQDJHIMV-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Cl)=CC=C1Cl)C |
| CAS DataBase Reference | 2476-37-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Dichloroacetophenone(2476-37-1) |
| EPA Substance Registry System | Ethanone, 1-(2,5-dichlorophenyl)- (2476-37-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/38-36/37/38 |
| Safety Statements | 24/25-36-26-37-23 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 2914790090 |
| Storage Class | 10 - Combustible liquids |
