trans-4-Pentylcyclohexanecarboxylic acid
- Product Nametrans-4-Pentylcyclohexanecarboxylic acid
- CAS38289-29-1
- MFC12H22O2
- MW198.3
- EINECS626-251-1
- MOL File38289-29-1.mol
Chemical Properties
| Melting point | 51-53 °C (lit.) |
| Boiling point | 295.63°C (rough estimate) |
| Density | 0.9590 (rough estimate) |
| refractive index | 1.4720 (estimate) |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 4.94±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C12H22O2/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14/h10-11H,2-9H2,1H3,(H,13,14)/t10-,11- |
| InChIKey | RVLAXPQGTRTHEV-XYPYZODXSA-N |
| SMILES | CCCCC[C@@H]1CC[C@H](CC1)C(O)=O |
| CAS DataBase Reference | 38289-29-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29162090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
