trans-4-Propylcyclohexanecarboxylic acid
- Product Nametrans-4-Propylcyclohexanecarboxylic acid
- CAS38289-27-9
- MFC10H18O2
- MW170.25
- EINECS679-815-4
- MOL File38289-27-9.mol
Chemical Properties
| Melting point | 93°C |
| Boiling point | 270.3±8.0 °C(Predicted) |
| Density | 0.985±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.92±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C10H18O2/c1-2-3-8-4-6-9(7-5-8)10(11)12/h8-9H,2-7H2,1H3,(H,11,12)/t8-,9- |
| InChIKey | QCNUKEGGHOLBES-KYZUINATSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@@H](CCC)CC1 |
| CAS DataBase Reference | 38289-27-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 26-36/37/39-60-37 |
| HS Code | 29162090 |
