Sodium 3-sulfobenzoate
- Product NameSodium 3-sulfobenzoate
- CAS17625-03-5
- MFC7H5O5S.Na
- MW224.17
- EINECS241-602-5
- MOL File17625-03-5.mol
Chemical Properties
| Melting point | ≥300 °C (lit.) |
| Boiling point | 365.41℃[at 101 325 Pa] |
| Density | 1.792[at 20℃] |
| vapor pressure | 0.003Pa at 60℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble25mg/mL, clear, colorless |
| form | powder to crystal |
| color | White to Almost white |
| Odor | essentially odorless |
| Water Solubility | 100g/L at 20.5℃ |
| BRN | 5675222 |
| InChI | InChI=1S/C7H6O5S.Na/c8-7(9)5-2-1-3-6(4-5)13(10,11)12;/h1-4H,(H,8,9)(H,10,11,12);/q;+1/p-1 |
| InChIKey | KQHKITXZJDOIOD-UHFFFAOYSA-M |
| SMILES | C1(S([O-])(=O)=O)C=CC=C(C(=O)O)C=1.[Na+] |
| LogP | 0.3 at 25℃ |
| CAS DataBase Reference | 17625-03-5(CAS DataBase Reference) |
| EPA Substance Registry System | 3-Sulfobenzoic acid monosodium salt (17625-03-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2916.39.7900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |