| Melting point |
≥300 °C (lit.) |
| Boiling point |
365.41℃[at 101 325 Pa] |
| Density |
1.792[at 20℃] |
| vapor pressure |
0.003Pa at 60℃ |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
water: soluble25mg/mL, clear, colorless |
| form |
powder to crystal |
| color |
White to Almost white |
| Odor |
essentially odorless |
| Water Solubility |
100g/L at 20.5℃ |
| BRN |
5675222 |
| InChI |
InChI=1S/C7H6O5S.Na/c8-7(9)5-2-1-3-6(4-5)13(10,11)12;/h1-4H,(H,8,9)(H,10,11,12);/q;+1/p-1 |
| InChIKey |
KQHKITXZJDOIOD-UHFFFAOYSA-M |
| SMILES |
C1(S([O-])(=O)=O)C=CC=C(C(=O)O)C=1.[Na+] |
| LogP |
0.3 at 25℃ |
| CAS DataBase Reference |
17625-03-5(CAS DataBase Reference) |
| EPA Substance Registry System |
3-Sulfobenzoic acid monosodium salt (17625-03-5) |
| UNSPSC Code |
12352100 |
| NACRES |
NA.22 |
