4'-tert-Butyl-4-chlorobutyrophenone
- Product Name4'-tert-Butyl-4-chlorobutyrophenone
- CAS43076-61-5
- MFC14H19ClO
- MW238.75
- EINECS256-077-8
- MOL File43076-61-5.mol
Chemical Properties
| Melting point | 47-49 °C(lit.) |
| Boiling point | 152 °C (1 mmHg) |
| Density | 1.0292 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| Flash point | 152-155°C/1mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 780343 |
| InChI | InChI=1S/C14H19ClO/c1-14(2,3)12-8-6-11(7-9-12)13(16)5-4-10-15/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | RLKSQLJFGCDUOX-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C(C)(C)C)C=C1)(=O)CCCCl |
| CAS DataBase Reference | 43076-61-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-41-43-51/53 |
| Safety Statements | 26-36/37/39-61-7/8-24/25 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| HS Code | 2914790090 |
