5-Bromo-2-fluorobenzaldehyde
- Product Name5-Bromo-2-fluorobenzaldehyde
- CAS93777-26-5
- MFC7H4BrFO
- MW203.01
- EINECS298-056-6
- MOL File93777-26-5.mol
Chemical Properties
| Melting point | 58-62°C |
| Boiling point | 230 °C (lit.) |
| Density | 1.71 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 229 °F |
| storage temp. | 2-8°C |
| form | powder to lump to clear liquid |
| color | White or Colorless to Light yellow |
| Specific Gravity | 1.710 |
| Water Solubility | INSOLUBLE |
| Sensitive | Air Sensitive |
| BRN | 7632798 |
| InChI | InChI=1S/C7H4BrFO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H |
| InChIKey | MMFGGDVQLQQQRX-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(Br)=CC=C1F |
| CAS DataBase Reference | 93777-26-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29130000 |
