Carbonic acid tert-butyl phthalimido ester
- Product NameCarbonic acid tert-butyl phthalimido ester
- CAS15263-20-4
- MFC13H13NO5
- MW263.25
- EINECS239-308-7
- MOL File15263-20-4.mol
Chemical Properties
| Melting point | 118 °C (dec.)(lit.) |
| Boiling point | 363.2±25.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C13H13NO5/c1-13(2,3)18-12(17)19-14-10(15)8-6-4-5-7-9(8)11(14)16/h4-7H,1-3H3 |
| InChIKey | MCWXBNWFVFOQAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)ON1C(=O)c2ccccc2C1=O |
| CAS DataBase Reference | 15263-20-4(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2925.19.4200 |
| Storage Class | 11 - Combustible Solids |
