2-Bromo-5-fluorobenzonitrile
- Product Name2-Bromo-5-fluorobenzonitrile
- CAS57381-39-2
- MFC7H3BrFN
- MW200.01
- EINECS260-711-9
- MOL File57381-39-2.mol
Chemical Properties
| Melting point | 92-95 °C(lit.) |
| Boiling point | 251.2±25.0 °C(Predicted) |
| Density | 1.69±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | powder to crystal |
| color | White to Yellow to Orange |
| BRN | 8678330 |
| InChI | InChI=1S/C7H3BrFN/c8-7-2-1-6(9)3-5(7)4-10/h1-3H |
| InChIKey | MDHNVHCZDCSTMS-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(F)=CC=C1Br |
| CAS DataBase Reference | 57381-39-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 26-36 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
