5-Nitrobenzofuran-2-carboxylic acid
- Product Name5-Nitrobenzofuran-2-carboxylic acid
- CAS10242-12-3
- MFC9H5NO5
- MW207.14
- EINECS
- MOL File10242-12-3.mol
Chemical Properties
| Melting point | 279-284 °C |
| Boiling point | 414.0±25.0 °C(Predicted) |
| Density | 1.584±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.77±0.30(Predicted) |
| color | White to Orange to Green |
| InChI | 1S/C9H5NO5/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8/h1-4H,(H,11,12) |
| InChIKey | LZKWLHXJPIKJSJ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc2cc(ccc2o1)[N+]([O-])=O |
| CAS DataBase Reference | 10242-12-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
