Ethyl 5-nitrobenzofuran-2-carboxylate
- Product NameEthyl 5-nitrobenzofuran-2-carboxylate
- CAS69604-00-8
- MFC11H9NO5
- MW235.19
- EINECS
- MOL File69604-00-8.mol
Chemical Properties
| Melting point | 152-156 °C |
| Boiling point | 377.58°C (rough estimate) |
| Density | 1.362 |
| refractive index | 1.4950 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | slightly sol. in Acetone |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| InChI | 1S/C11H9NO5/c1-2-16-11(13)10-6-7-5-8(12(14)15)3-4-9(7)17-10/h3-6H,2H2,1H3 |
| InChIKey | ATHBGWVHAWGMAL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc(ccc2o1)[N+]([O-])=O |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
| Storage Class | 13 - Non Combustible Solids |