2,5-Difluorophenol
- Product Name2,5-Difluorophenol
- CAS2713-31-7
- MFC6H4F2O
- MW130.09
- EINECS
- MOL File2713-31-7.mol
Chemical Properties
| Melting point | 40-42 °C (lit.) |
| Boiling point | 145 °C |
| Density | 1.2483 (estimate) |
| Flash point | 128 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to lump |
| pka | 7.71±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | slightly soluble |
| BRN | 2081076 |
| InChI | InChI=1S/C6H4F2O/c7-4-1-2-5(8)6(9)3-4/h1-3,9H |
| InChIKey | INXKVYFOWNAVMU-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=CC=C1F |
| CAS DataBase Reference | 2713-31-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Difluorophenol(2713-31-7) |
Safety Information
| Hazard Codes | Xn,Xi,C,F |
| Risk Statements | 10-20/21/22-36/37/38-34-11 |
| Safety Statements | 16-26-36/37-45-36/37/39-36 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29329970 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Sol. 1 Skin Irrit. 2 STOT SE 3 |
