N-Cyclohexylaniline
- Product NameN-Cyclohexylaniline
- CAS1821-36-9
- MFC12H17N
- MW175.27
- EINECS217-344-4
- MOL File1821-36-9.mol
Chemical Properties
| Melting point | 14-15°C |
| Boiling point | 191-192 °C (73 mmHg) |
| Density | 0.996 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point | 136 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 5.46±0.20(Predicted) |
| form | liquid |
| color | Orange |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 2209864 |
| InChI | InChI=1S/C12H17N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1,3-4,7-8,12-13H,2,5-6,9-10H2 |
| InChIKey | TXTHKGMZDDTZFD-UHFFFAOYSA-N |
| SMILES | C1(NC2CCCCC2)=CC=CC=C1 |
| CAS DataBase Reference | 1821-36-9(CAS DataBase Reference) |
| EPA Substance Registry System | N-Cyclohexylaniline (1821-36-9) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 23-36/37 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29214900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Skin Irrit. 2 STOT SE 3 |