4-Nitrothioanisole
- Product Name4-Nitrothioanisole
- CAS701-57-5
- MFC7H7NO2S
- MW169.2
- EINECS677-868-8
- MOL File701-57-5.mol
Chemical Properties
| Melting point | 66-69 °C (lit.) 68-72 °C (lit.) |
| Boiling point | 140 °C / 2mmHg |
| Density | 1.2391 |
| refractive index | 1.6401 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| Sensitive | Stench |
| BRN | 1817928 |
| InChI | InChI=1S/C7H7NO2S/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3 |
| InChIKey | NEZGPRYOJVPJKL-UHFFFAOYSA-N |
| SMILES | C1(SC)=CC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 701-57-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Methyl 4-nitrophenyl sulphide(701-57-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-36/37/39-36/37 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Stench |
| HazardClass | IRRITANT, STENCH |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |