4-(Methylmercapto)aniline
- Product Name4-(Methylmercapto)aniline
- CAS104-96-1
- MFC7H9NS
- MW139.22
- EINECS203-256-3
- MOL File104-96-1.mol
Chemical Properties
| Melting point | 156-158 °C |
| Boiling point | 273 °C |
| Density | 1.14 |
| refractive index | 1.64 |
| Flash point | 110 °C - closed cup |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.35(at 25℃) |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| Sensitive | Stench |
| BRN | 774506 |
| InChI | InChI=1S/C7H9NS/c1-9-7-4-2-6(8)3-5-7/h2-5H,8H2,1H3 |
| InChIKey | YKFROQCFVXOUPW-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(SC)C=C1 |
| CAS DataBase Reference | 104-96-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Methylmercaptoaniline(104-96-1) |
| EPA Substance Registry System | Benzenamine, 4-(methylthio)- (104-96-1) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | BY6302000 |
| F | 2-8-10-13 |
| Hazard Note | Irritant/Stench |
| TSCA | TSCA listed |
| HazardClass | IRRITANT, STENCH |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2930909099 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 orl-qal: 562 mg/kg AECTCV 12,355,83 |
