4-Amino-4'-nitrodiphenyl sulfide
- Product Name4-Amino-4'-nitrodiphenyl sulfide
- CAS101-59-7
- MFC12H10N2O2S
- MW246.29
- EINECS202-957-1
- MOL File101-59-7.mol
Chemical Properties
| Melting point | 143-145 °C(lit.) |
| Boiling point | 479.1±30.0 °C(Predicted) |
| Density | 1.3031 (rough estimate) |
| refractive index | 1.5950 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.99±0.10(Predicted) |
| color | Orange prisms with blue reflex from C6H6, crystfrom EtOH |
| InChI | 1S/C12H10N2O2S/c13-9-1-5-11(6-2-9)17-12-7-3-10(4-8-12)14(15)16/h1-8H,13H2 |
| InChIKey | ZBPKGHOGUVVDLF-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Sc2ccc(cc2)[N+]([O-])=O)cc1 |
| CAS DataBase Reference | 101-59-7(CAS DataBase Reference) |
| EPA Substance Registry System | 4-[(4-Nitrophenyl)thio]aniline (101-59-7) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | WP9640000 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mmo-sat 25 mg/plate MUREAV 67,123,79 |