1-Boc-3-hydroxymethylpyrrolidine
- Product Name1-Boc-3-hydroxymethylpyrrolidine
- CAS114214-69-6
- MFC10H19NO3
- MW201.26
- EINECS
- MOL File114214-69-6.mol
Chemical Properties
| Boiling point | 285-291℃ |
| Density | 1.089 |
| refractive index | 1.4680 to 1.4720 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 14.93±0.10(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-5-4-8(6-11)7-12/h8,12H,4-7H2,1-3H3 |
| InChIKey | HKIGXXRMJFUUKV-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(CO)C1 |
| CAS DataBase Reference | 114214-69-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N,T |
| Risk Statements | 25-50 |
| Safety Statements | 24/25-61-45 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |