2-Isocyanatoethyl methacrylate
- Product Name2-Isocyanatoethyl methacrylate
- CAS30674-80-7
- MFC7H9NO3
- MW155.15
- EINECS250-284-7
- MOL File30674-80-7.mol
Chemical Properties
| Melting point | -45 °C (lit.) |
| Boiling point | 211 °C (lit.) |
| Density | 1.098 g/mL at 25 °C (lit.) |
| vapor pressure | 18Pa at 20℃ |
| refractive index | n |
| Flash point | 207 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | 4.214g/L at 25℃ |
| InChI | InChI=1S/C7H9NO3/c1-6(2)7(10)11-4-3-8-5-9/h1,3-4H2,2H3 |
| InChIKey | RBQRWNWVPQDTJJ-UHFFFAOYSA-N |
| SMILES | C(OCCN=C=O)(=O)C(C)=C |
| LogP | 1.72 |
| EPA Substance Registry System | Methacryloyloxyethyl isocyanate (30674-80-7) |
Safety Information
| Hazard Codes | T+,T |
| Risk Statements | 21/22-26-37/38-41-42-42/43-36/37/38-23-22 |
| Safety Statements | 26-36/37/39-45-36/37-23 |
| RIDADR | UN 2206 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | OZ4950000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29291090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 30674-80-7(Hazardous Substances Data) |
| Toxicity | rat,LC50,inhalation,4ppm/6H (4ppm),Drug and Chemical Toxicology. Vol. 3, Pg. 381, 1980. |
