3-methyl-4-propan-2-ylphenol
- Product Name3-methyl-4-propan-2-ylphenol
- CAS3228-02-2
- MFC10H14O
- MW150.22
- EINECS221-761-7
- MOL File3228-02-2.mol
Chemical Properties
| Melting point | 111-114 °C(lit.) |
| Boiling point | 246 °C |
| Density | 0.9688 (estimate) |
| vapor pressure | 1.81Pa at 25℃ |
| refractive index | 1.5115 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 10.36±0.18(Predicted) |
| color | White to Almost white |
| Water Solubility | 210mg/L at 20℃ |
| Cosmetics Ingredients Functions | DEODORANT PRESERVATIVE ANTIMICROBIAL |
| InChI | InChI=1S/C10H14O/c1-7(2)10-5-4-9(11)6-8(10)3/h4-7,11H,1-3H3 |
| InChIKey | IJALWSVNUBBQRA-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C(C)C)C(C)=C1 |
| LogP | 3.43 |
| CAS DataBase Reference | 3228-02-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 1759 |
| WGK Germany | 2 |
| RTECS | GZ7170000 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29071990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |