Vinyl tris(trimethylsiloxy)silane
- Product NameVinyl tris(trimethylsiloxy)silane
- CAS5356-84-3
- MFC11H30O3Si4
- MW322.7
- EINECS226-342-2
- MOL File5356-84-3.mol
Chemical Properties
| Boiling point | 86.5-87.5 °C/15 mmHg (lit.) |
| Density | 0.861 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 150 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.8657 |
| Water Solubility | insoluble |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 1795324 |
| InChI | InChI=1S/C11H30O3Si4/c1-11-18(12-15(2,3)4,13-16(5,6)7)14-17(8,9)10/h11H,1H2,2-10H3 |
| InChIKey | CHEFFAKKAFRMHG-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C)O[Si](C=C)(O[Si](C)(C)C)O[Si](C)(C)C |
| EPA Substance Registry System | Trisiloxane, 3-ethenyl-1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]- (5356-84-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-10 |
| Safety Statements | 26-36-37/39-16 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29310099 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
