5-Bromo-4-chloro-3-indolyl acetate
- Product Name5-Bromo-4-chloro-3-indolyl acetate
- CAS3252-36-6
- MFC10H7BrClNO2
- MW288.53
- EINECS
- MOL File3252-36-6.mol
Chemical Properties
| Melting point | 106-107℃ |
| Boiling point | 429℃ |
| Density | 1.721 |
| Flash point | 213℃ |
| storage temp. | -20°C |
| solubility | ethanol: 50mg/mL, clear, colorless to faintly yellow |
| form | powder to crystal |
| pka | 14.03±0.30(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C10H7BrClNO2/c1-5(14)15-8-4-13-7-3-2-6(11)10(12)9(7)8/h2-4,13H,1H3 |
| InChIKey | WPWLFFMSSOAORQ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(Cl)=C(Br)C=C2)C(OC(=O)C)=C1 |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
