| Melting point |
128-130 °C(lit.) |
| Boiling point |
306.47°C (rough estimate) |
| Density |
1.1999 (rough estimate) |
| refractive index |
1.5060 (estimate) |
| storage temp. |
2-8°C |
| solubility |
DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form |
Glistening Crystals |
| pka |
15.89±0.30(Predicted) |
| color |
Colorless to lilac |
| Water Solubility |
Soluble in ethanol, water, chloroform, dichloromethane and methanol. |
| BRN |
143086 |
| InChI |
InChI=1S/C10H9NO2/c1-7(12)13-10-6-11-9-5-3-2-4-8(9)10/h2-6,11H,1H3 |
| InChIKey |
JBOPQACSHPPKEP-UHFFFAOYSA-N |
| SMILES |
N1C2=C(C=CC=C2)C(OC(=O)C)=C1 |
| CAS DataBase Reference |
608-08-2(CAS DataBase Reference) |
| EPA Substance Registry System |
3-Indoxyl acetate (608-08-2) |
