5-Bromo-4-chloro-3-indolyl phosphate disodium salt
- Product Name5-Bromo-4-chloro-3-indolyl phosphate disodium salt
- CAS102185-33-1
- MFC8H7BrClNNaO4P
- MW350.46
- EINECS600-286-2
- MOL File102185-33-1.mol
Chemical Properties
| Melting point | 300°C |
| storage temp. | -20°C |
| solubility | H2O: 20 mg/mL |
| form | powder |
| color | Clear pale yellow to yellow |
| Water Solubility | Soluble in water and toluene. |
| Sensitive | Moisture & Light Sensitive |
| InChI | InChI=1S/C8H6BrClNO4P.Na.H/c9-4-1-2-5-7(8(4)10)6(3-11-5)15-16(12,13)14;;/h1-3,11H,(H2,12,13,14);; |
| InChIKey | NJXRUEXXWITWDD-UHFFFAOYSA-N |
| SMILES | O(C1=CNC2C=CC(Br)=C(Cl)C1=2)P(O)(O)=O.[NaH] |
| CAS DataBase Reference | 102185-33-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 29339190 |
| Storage Class | 11 - Combustible Solids |
