(Phenylthio)acetic acid
- Product Name(Phenylthio)acetic acid
- CAS103-04-8
- MFC8H8O2S
- MW168.21
- EINECS203-073-9
- MOL File103-04-8.mol
Chemical Properties
| Melting point | 60-63 °C (lit.) |
| Boiling point | 314.4±25.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 3.70±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 2045072 |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChI | InChI=1S/C8H8O2S/c9-8(10)6-11-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) |
| InChIKey | MOTOSAGBNXXRRE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CSC1=CC=CC=C1 |
| CAS DataBase Reference | 103-04-8(CAS DataBase Reference) |
| EPA Substance Registry System | (Phenylthio)acetic acid (103-04-8) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HazardClass | 9 |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
