Methyl phenylsulfonylacetate
- Product NameMethyl phenylsulfonylacetate
- CAS34097-60-4
- MFC9H10O4S
- MW214.24
- EINECS
- MOL File34097-60-4.mol
Chemical Properties
| Melting point | 30°C |
| Boiling point | 165 °C/0.05 mmHg (lit.) |
| Density | 1.305 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid to slightly cloudy liquid |
| Specific Gravity | 1.282 |
| color | Light orange to Yellow to Green |
| Water Solubility | Insoluble in water. |
| BRN | 2051463 |
| InChI | InChI=1S/C9H10O4S/c1-13-9(10)7-14(11,12)8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | NLEAIFBNKPYTGN-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CS(C1=CC=CC=C1)(=O)=O |
| CAS DataBase Reference | 34097-60-4(CAS DataBase Reference) |
Safety Information
| Risk Statements | 10 |
| Safety Statements | 23-24/25-43-36/37/39-15/16 |
| WGK Germany | 3 |
| HS Code | 29309090 |
| Storage Class | 10 - Combustible liquids |
