4-Methoxyazobenzene
- Product Name4-Methoxyazobenzene
- CAS2396-60-3
- MFC13H12N2O
- MW212.25
- EINECS219-250-9
- MOL File2396-60-3.mol
Chemical Properties
| Melting point | 54-56 °C |
| Boiling point | 340 °C |
| Density | 1.1200 |
| refractive index | 1.6920 (estimate) |
| form | powder to crystal |
| color | Light yellow to Brown |
| BRN | 958054 |
| InChI | 1S/C13H12N2O/c1-16-13-9-7-12(8-10-13)15-14-11-5-3-2-4-6-11/h2-10H,1H3/b15-14+ |
| InChIKey | LGCRPKOHRIXSEG-CCEZHUSRSA-N |
| SMILES | COc1ccc(cc1)\N=N\c2ccccc2 |
| CAS DataBase Reference | 2396-60-3(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2927.00.5000 |
| Storage Class | 11 - Combustible Solids |
