4,4'-AZOXYANISOLE
- Product Name4,4'-AZOXYANISOLE
- CAS1562-94-3
- MFC14H14N2O3
- MW258.27
- EINECS216-348-3
- MOL File1562-94-3.mol
Chemical Properties
| Melting point | 117-119 °C (lit.) |
| Boiling point | 401.53°C (rough estimate) |
| Density | 1.14 |
| refractive index | 1.6419 (estimate) |
| storage temp. | -20°C |
| form | powder to crystal |
| color | Light yellow to Brown |
| BRN | 752723 |
| Dielectric constant | 2.3（50.0℃） |
| InChI | 1S/C14H14N2O3/c1-18-13-7-3-11(4-8-13)15-16(17)12-5-9-14(19-2)10-6-12/h3-10H,1-2H3/b16-15- |
| InChIKey | KAEZRSFWWCTVNP-NXVVXOECSA-N |
| SMILES | COc1ccc(cc1)\N=[N+](/[O-])c2ccc(OC)cc2 |
| CAS DataBase Reference | 1562-94-3(CAS DataBase Reference) |
| EPA Substance Registry System | 4,4'-Azoxyanisole (1562-94-3) |
Safety Information
| Hazard Codes | Xn-F |
| Risk Statements | 20/21/22-11 |
| Safety Statements | 36/37/39-26-22-16-24/25 |
| WGK Germany | 3 |
| RTECS | HM2966500 |
| TSCA | TSCA listed |
| HS Code | 29270000 |
| Storage Class | 11 - Combustible Solids |
