2,6-Dihydroxyanthraquinone
- Product Name2,6-Dihydroxyanthraquinone
- CAS84-60-6
- MFC14H8O4
- MW240.21
- EINECS201-544-3
- MOL File84-60-6.mol
Chemical Properties
| Melting point | >320 °C(lit.) |
| Boiling point | 342.92°C (rough estimate) |
| Density | 1.3032 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO |
| form | powder to crystal |
| pka | 6.72±0.20(Predicted) |
| color | Light yellow to Brown to Dark green |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H |
| InChIKey | APAJFZPFBHMFQR-UHFFFAOYSA-N |
| SMILES | Oc1ccc2C(=O)c3cc(O)ccc3C(=O)c2c1 |
| LogP | 3.360 (est) |
| CAS DataBase Reference | 84-60-6(CAS DataBase Reference) |
| EPA Substance Registry System | 9,10-Anthracenedione, 2,6-dihydroxy- (84-60-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36/37 |
| WGK Germany | 3 |
| RTECS | CB6675000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
