| Melting point |
125-127 °C(lit.) |
| alpha |
-7°(23℃, c=0.6, CH3OH) |
| Boiling point |
398.8±25.0 °C(Predicted) |
| Density |
1.118±0.06 g/cm3(Predicted) |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| solubility |
soluble in Chloroform, Dichloromethane, Ethyl Acetate, Methanol |
| pka |
12.19±0.46(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| optical activity |
[α]23/D 7°, c = 0.6 in methanol |
| Water Solubility |
Insoluble in water. Soluble in Chloroform, Dichloromethane and Ethyl Acetate. |
| InChI |
InChI=1S/C15H21NO3/c1-15(2,3)19-14(17)16-12(13-10-18-13)9-11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3,(H,16,17)/t12-,13+/m0/s1 |
| InChIKey |
NVPOUMXZERMIJK-QWHCGFSZSA-N |
| SMILES |
C(OC(C)(C)C)(=O)N[C@H]([C@H]1CO1)CC1=CC=CC=C1 |
| CAS DataBase Reference |
98737-29-2(CAS DataBase Reference) |
