1,2-Bis(trimethoxysilyl)ethane
- Product Name1,2-Bis(trimethoxysilyl)ethane
- CAS18406-41-2
- MFC8H22O6Si2
- MW270.43
- EINECS242-285-6
- MOL File18406-41-2.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 103-104 °C5 mm Hg(lit.) |
| Density | 1.073 g/mL at 25 °C(lit.) |
| vapor pressure | 1.2Pa at 20℃ |
| refractive index | n |
| Flash point | 228 °F |
| form | Liquid |
| Specific Gravity | 1.09 |
| color | Colorless |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C8H22O6Si2/c1-9-15(10-2,11-3)7-8-16(12-4,13-5)14-6/h7-8H2,1-6H3 |
| InChIKey | JCGDCINCKDQXDX-UHFFFAOYSA-N |
| SMILES | CO[Si](OC)(OC)CC[Si](OC)(OC)OC |
| LogP | -1.68 at 25℃ |
| CAS DataBase Reference | 18406-41-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2,7-Dioxa-3,6-disilaoctane, 3,3,6,6-tetramethoxy- (18406-41-2) |
Safety Information
| Hazard Codes | T+ |
| Risk Statements | 26 |
| Safety Statements | 23-36/37-45 |
| RIDADR | UN 3382 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | JG7873000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| HS Code | 29319090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation |
