1,2-Bis(triethoxysilyl)ethane
- Product Name1,2-Bis(triethoxysilyl)ethane
- CAS16068-37-4
- MFC14H34O6Si2
- MW354.59
- EINECS240-212-2
- MOL File16068-37-4.mol
Chemical Properties
| Melting point | -20-10°C |
| Boiling point | 119 °C(lit.) |
| Density | 0.958 g/mL at 25 °C(lit.) |
| vapor pressure | 0-7910Pa at 20-25℃ |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.957 |
| Water Solubility | Soluble in alcohol, aromatic and aliphatic hydrocarbons. Hydrolyzes with water. |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | 1S/C14H34O6Si2/c1-7-15-21(16-8-2,17-9-3)13-14-22(18-10-4,19-11-5)20-12-6/h7-14H2,1-6H3 |
| InChIKey | IZRJPHXTEXTLHY-UHFFFAOYSA-N |
| SMILES | CCO[Si](CC[Si](OCC)(OCC)OCC)(OCC)OCC |
| LogP | -4-2.7 at 20-25℃ |
| CAS DataBase Reference | 16068-37-4 |
| EPA Substance Registry System | 3,8-Dioxa-4,7-disiladecane, 4,4,7,7-tetraethoxy- (16068-37-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41-38-37-36 |
| Safety Statements | 26-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | JG7755000 |
| TSCA | TSCA listed |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Chronic 3 STOT RE 1 Inhalation |
