N-(2-Hydroxyethyl)-N-methyl-4-toluidine
- Product NameN-(2-Hydroxyethyl)-N-methyl-4-toluidine
- CAS2842-44-6
- MFC10H15NO
- MW165.23
- EINECS220-638-5
- MOL File2842-44-6.mol
Chemical Properties
| Boiling point | 152-154 °C(Press: 10 Torr) |
| Density | 1.047±0.06 g/cm3(Predicted) |
| vapor pressure | 0.062-0.115Pa at 20-25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid:viscous |
| pka | 14.69±0.10(Predicted) |
| Cosmetics Ingredients Functions | FILM FORMING NAIL CONDITIONING |
| InChI | InChI=1S/C10H15NO/c1-9-3-5-10(6-4-9)11(2)7-8-12/h3-6,12H,7-8H2,1-2H3 |
| InChIKey | HXCWOOAEAHVMBJ-UHFFFAOYSA-N |
| SMILES | C(O)CN(C)C1=CC=C(C)C=C1 |
| LogP | 2.2 at 25℃ and pH6 |
| EPA Substance Registry System | Ethanol, 2-[methyl(4-methylphenyl)amino]- (2842-44-6) |
Fig The synthetic method of N-(2-hydroxyethyl)-N-methyl-4-toluidine