N-Methyl-p-toluidine
- Product NameN-Methyl-p-toluidine
- CAS623-08-5
- MFC8H11N
- MW121.18
- EINECS210-769-6
- MOL File623-08-5.mol
Chemical Properties
| Melting point | -10.08°C (estimate) |
| Boiling point | 212 °C(lit.) |
| Density | 0.958 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 183 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 5.26±0.12(Predicted) |
| form | clear liquid |
| color | Colorless to Orange to Green |
| InChI | InChI=1S/C8H11N/c1-7-3-5-8(9-2)6-4-7/h3-6,9H,1-2H3 |
| InChIKey | QCIFLGSATTWUQJ-UHFFFAOYSA-N |
| SMILES | C1(NC)=CC=C(C)C=C1 |
| CAS DataBase Reference | 623-08-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, N,4-dimethyl- (623-08-5) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25-33-52/53 |
| Safety Statements | 28-36/37-45-61-28A |
| RIDADR | UN 2810 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29214300 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 3 STOT RE 2 |
