2-Bromo-5-fluorotoluene
- Product Name2-Bromo-5-fluorotoluene
- CAS452-63-1
- MFC7H6BrF
- MW189.02
- EINECS207-203-5
- MOL File452-63-1.mol
Chemical Properties
| Boiling point | 177 °C/756 mmHg (lit.) |
| Density | 1.495 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 113 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Difficult to mix. |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.495 |
| Water Solubility | INSOLUBLE |
| BRN | 1859121 |
| InChI | InChI=1S/C7H6BrF/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| InChIKey | RJPNVPITBYXBNB-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(F)C=C1C |
| CAS DataBase Reference | 452-63-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromo-5-fluorotoluene(452-63-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36/37/39-37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |